C24H34O13 — CID 174926190
benzene-1,2,4,5-tetracarboxylic acid;[4-hydroxy-3,3-bis(hydroxymethyl)butyl] octanoate (PubChem CID 174926190) has the molecular formula C24H34O13 and a molecular weight of 530.52 g/mol. Its IUPAC name is benzene-1,2,4,5-tetracarboxylic acid;[4-hydroxy-3,3-bis(hydroxymethyl)butyl] octanoate.
| Compound Name | benzene-1,2,4,5-tetracarboxylic acid;[4-hydroxy-3,3-bis(hydroxymethyl)butyl] octanoate |
|---|---|
| PubChem CID | 174926190 |
| Molecular Formula | C24H34O13 |
| Molecular Weight | 530.52 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | benzene-1,2,4,5-tetracarboxylic acid;[4-hydroxy-3,3-bis(hydroxymethyl)butyl] octanoate |
| SMILES | CCCCCCCC(=O)OCCC(CO)(CO)CO.O=C(O)c1cc(C(=O)O)c(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C14H28O5.C10H6O8/c1-2-3-4-5-6-7-13(18)19-9-8-14(10-15,11-16)12-17;11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16/h15-17H,2-12H2,1H3;1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | LLWWWCMZDDRHSA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 236.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|