C14H26O8 — CID 175035735
1-O-[4-hydroxy-3,3-bis(hydroxymethyl)butyl] 6-O-(2-hydroxyethyl) hexanedioate (PubChem CID 175035735) has the molecular formula C14H26O8 and a molecular weight of 322.35 g/mol. Its IUPAC name is 1-O-[4-hydroxy-3,3-bis(hydroxymethyl)butyl] 6-O-(2-hydroxyethyl) hexanedioate.
| Compound Name | 1-O-[4-hydroxy-3,3-bis(hydroxymethyl)butyl] 6-O-(2-hydroxyethyl) hexanedioate |
|---|---|
| PubChem CID | 175035735 |
| Molecular Formula | C14H26O8 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 1-O-[4-hydroxy-3,3-bis(hydroxymethyl)butyl] 6-O-(2-hydroxyethyl) hexanedioate |
| SMILES | O=C(CCCCC(=O)OCCC(CO)(CO)CO)OCCO |
| InChI | InChI=1S/C14H26O8/c15-6-8-22-13(20)4-2-1-3-12(19)21-7-5-14(9-16,10-17)11-18/h15-18H,1-11H2 |
| InChIKey | UAUKTVDSZTYEQG-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|