C24H48O5 — CID 57148830
[4-hydroxy-3,3-bis(hydroxymethyl)butyl] 9-methylheptadecanoate (PubChem CID 57148830) has the molecular formula C24H48O5 and a molecular weight of 416.64 g/mol. Its IUPAC name is [4-hydroxy-3,3-bis(hydroxymethyl)butyl] 9-methylheptadecanoate.
| Compound Name | [4-hydroxy-3,3-bis(hydroxymethyl)butyl] 9-methylheptadecanoate |
|---|---|
| PubChem CID | 57148830 |
| Molecular Formula | C24H48O5 |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.35 |
| IUPAC Name | [4-hydroxy-3,3-bis(hydroxymethyl)butyl] 9-methylheptadecanoate |
| SMILES | CCCCCCCCC(C)CCCCCCCC(=O)OCCC(CO)(CO)CO |
| InChI | InChI=1S/C24H48O5/c1-3-4-5-6-8-11-14-22(2)15-12-9-7-10-13-16-23(28)29-18-17-24(19-25,20-26)21-27/h22,25-27H,3-21H2,1-2H3 |
| InChIKey | FYDPJDDPLVODJT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|