C16H32O5 — CID 87579643
[4-hydroxy-3,3-bis(hydroxymethyl)butyl] decanoate (PubChem CID 87579643) has the molecular formula C16H32O5 and a molecular weight of 304.43 g/mol. Its IUPAC name is [4-hydroxy-3,3-bis(hydroxymethyl)butyl] decanoate.
| Compound Name | [4-hydroxy-3,3-bis(hydroxymethyl)butyl] decanoate |
|---|---|
| PubChem CID | 87579643 |
| Molecular Formula | C16H32O5 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | [4-hydroxy-3,3-bis(hydroxymethyl)butyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OCCC(CO)(CO)CO |
| InChI | InChI=1S/C16H32O5/c1-2-3-4-5-6-7-8-9-15(20)21-11-10-16(12-17,13-18)14-19/h17-19H,2-14H2,1H3 |
| InChIKey | XWLLYQNTIIZWRW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|