C17H36O5 — CID 175277806
2-ethyl-2-(hydroxymethyl)pentane-1,5-diol;propyl hexanoate (PubChem CID 175277806) has the molecular formula C17H36O5 and a molecular weight of 320.47 g/mol. Its IUPAC name is 2-ethyl-2-(hydroxymethyl)pentane-1,5-diol;propyl hexanoate.
| Compound Name | 2-ethyl-2-(hydroxymethyl)pentane-1,5-diol;propyl hexanoate |
|---|---|
| PubChem CID | 175277806 |
| Molecular Formula | C17H36O5 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | 2-ethyl-2-(hydroxymethyl)pentane-1,5-diol;propyl hexanoate |
| SMILES | CCC(CO)(CO)CCCO.CCCCCC(=O)OCCC |
| InChI | InChI=1S/C9H18O2.C8H18O3/c1-3-5-6-7-9(10)11-8-4-2;1-2-8(6-10,7-11)4-3-5-9/h3-8H2,1-2H3;9-11H,2-7H2,1H3 |
| InChIKey | DKBJEVZPKHQLTR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|