C20H36O12 — CID 88739197
(Z)-4-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobut-2-enoic acid (PubChem CID 88739197) has the molecular formula C20H36O12 and a molecular weight of 468.50 g/mol. Its IUPAC name is (Z)-4-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 88739197 |
| Molecular Formula | C20H36O12 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | (Z)-4-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)OCCOCCOCCOCCOCCOCCOCCOCCO |
| InChI | InChI=1S/C20H36O12/c21-3-4-25-5-6-26-7-8-27-9-10-28-11-12-29-13-14-30-15-16-31-17-18-32-20(24)2-1-19(22)23/h1-2,21H,3-18H2,(H,22,23)/b2-1- |
| InChIKey | UEQZTDYTPZXCKR-UPHRSURJSA-N |
| XLogP | -0.72 |
| TPSA | 148.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|