C14H23NO8 — CID 163700364
1-O-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl] 4-O-[(methylideneamino)methyl] (E)-but-2-enedioate (PubChem CID 163700364) has the molecular formula C14H23NO8 and a molecular weight of 333.34 g/mol. Its IUPAC name is 1-O-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl] 4-O-[(methylideneamino)methyl] (E)-but-2-enedioate.
| Compound Name | 1-O-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl] 4-O-[(methylideneamino)methyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 163700364 |
| Molecular Formula | C14H23NO8 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 1-O-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl] 4-O-[(methylideneamino)methyl] (E)-but-2-enedioate |
| SMILES | C=NCOC(=O)/C=C/C(=O)OCCOCCOCCOCCO |
| InChI | InChI=1S/C14H23NO8/c1-15-12-23-14(18)3-2-13(17)22-11-10-21-9-8-20-7-6-19-5-4-16/h2-3,16H,1,4-12H2/b3-2+ |
| InChIKey | KALROVJCQJMJTJ-NSCUHMNNSA-N |
| XLogP | -0.67 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|