C14H20Cl2O7 — CID 54570646
2-[2-[2-[2-(3-chloroprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]ethyl 3-chloroprop-2-enoate (PubChem CID 54570646) has the molecular formula C14H20Cl2O7 and a molecular weight of 371.21 g/mol. Its IUPAC name is 2-[2-[2-[2-(3-chloroprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]ethyl 3-chloroprop-2-enoate.
| Compound Name | 2-[2-[2-[2-(3-chloroprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]ethyl 3-chloroprop-2-enoate |
|---|---|
| PubChem CID | 54570646 |
| Molecular Formula | C14H20Cl2O7 |
| Molecular Weight | 371.21 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 2-[2-[2-[2-(3-chloroprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]ethyl 3-chloroprop-2-enoate |
| SMILES | O=C(C=CCl)OCCOCCOCCOCCOC(=O)C=CCl |
| InChI | InChI=1S/C14H20Cl2O7/c15-3-1-13(17)22-11-9-20-7-5-19-6-8-21-10-12-23-14(18)2-4-16/h1-4H,5-12H2 |
| InChIKey | ZWZVIEXXDQIXFU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|