5-ethenoxypent-2-enoic acid

C7H10O3 — CID 173182638

IUPAC5-ethenoxypent-2-enoic acid
SMILESC=COCCC=CC(=O)O
InChIInChI=1S/C7H10O3/c1-2-10-6-4-3-5-7(8)9/h2-3,5H,1,4,6H2,(H,8,9)
InChIKeyAKZTYECBDSNAHH-UHFFFAOYSA-N
MW142.15 g/mol
LogP1.18
Rot. Bonds5

About 5-ethenoxypent-2-enoic acid

5-ethenoxypent-2-enoic acid (PubChem CID 173182638) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is 5-ethenoxypent-2-enoic acid.

Molecular Properties

Compound Name5-ethenoxypent-2-enoic acid
PubChem CID173182638
Molecular FormulaC7H10O3
Molecular Weight142.15 g/mol
Exact Mass142.06
IUPAC Name5-ethenoxypent-2-enoic acid
SMILESC=COCCC=CC(=O)O
InChIInChI=1S/C7H10O3/c1-2-10-6-4-3-5-7(8)9/h2-3,5H,1,4,6H2,(H,8,9)
InChIKeyAKZTYECBDSNAHH-UHFFFAOYSA-N
XLogP1.18
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.15
LogP ≤ 51.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 5-ethenoxypent-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-ethenoxypent-2-enoic acid?
The IUPAC name of 5-ethenoxypent-2-enoic acid (CID 173182638) is 5-ethenoxypent-2-enoic acid.
What is the SMILES notation for 5-ethenoxypent-2-enoic acid?
The canonical SMILES for 5-ethenoxypent-2-enoic acid is C=COCCC=CC(=O)O.
What is the InChIKey of 5-ethenoxypent-2-enoic acid?
The InChIKey is AKZTYECBDSNAHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-2-10-6-4-3-5-7(8)9/h2-3,5H,1,4,6H2,(H,8,9).
What are the key properties of 5-ethenoxypent-2-enoic acid?
5-ethenoxypent-2-enoic acid has a molecular weight of 142.15 g/mol, XLogP of 1.18, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenoxypent-2-enoic acid is sourced from PubChem (CID 173182638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).