C16H34O7 — CID 6428225
2-[2-[2-[2-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 6428225) has the molecular formula C16H34O7 and a molecular weight of 338.44 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 6428225 |
| Molecular Formula | C16H34O7 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | CC(C)COCCOCCOCCOCCOCCOCCO |
| InChI | InChI=1S/C16H34O7/c1-16(2)15-23-14-13-22-12-11-21-10-9-20-8-7-19-6-5-18-4-3-17/h16-17H,3-15H2,1-2H3 |
| InChIKey | YAXANHFNMATPNL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|