C25H38O3 — CID 171512659
1-methyl-4-[2-(4-methylphenyl)propan-2-yl]benzene;2-[2-(2-methylpropoxy)ethoxy]ethanol (PubChem CID 171512659) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is 1-methyl-4-[2-(4-methylphenyl)propan-2-yl]benzene;2-[2-(2-methylpropoxy)ethoxy]ethanol.
| Compound Name | 1-methyl-4-[2-(4-methylphenyl)propan-2-yl]benzene;2-[2-(2-methylpropoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 171512659 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 1-methyl-4-[2-(4-methylphenyl)propan-2-yl]benzene;2-[2-(2-methylpropoxy)ethoxy]ethanol |
| SMILES | CC(C)COCCOCCO.Cc1ccc(C(C)(C)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H20.C8H18O3/c1-13-5-9-15(10-6-13)17(3,4)16-11-7-14(2)8-12-16;1-8(2)7-11-6-5-10-4-3-9/h5-12H,1-4H3;8-9H,3-7H2,1-2H3 |
| InChIKey | NFIKCVRUKDWPPP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|