C25H35ClO5 — CID 90381443
2-[2-[2-[4-[2-[4-[(2S)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]ethoxy]ethoxy]ethanol (PubChem CID 90381443) has the molecular formula C25H35ClO5 and a molecular weight of 451.00 g/mol. Its IUPAC name is 2-[2-[2-[4-[2-[4-[(2S)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[4-[2-[4-[(2S)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 90381443 |
| Molecular Formula | C25H35ClO5 |
| Molecular Weight | 451.00 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 2-[2-[2-[4-[2-[4-[(2S)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]ethoxy]ethoxy]ethanol |
| SMILES | CC(CCl)COc1ccc(C(C)(C)c2ccc(OCCOCCOCCO)cc2)cc1 |
| InChI | InChI=1S/C25H35ClO5/c1-20(18-26)19-31-24-10-6-22(7-11-24)25(2,3)21-4-8-23(9-5-21)30-17-16-29-15-14-28-13-12-27/h4-11,20,27H,12-19H2,1-3H3 |
| InChIKey | BFKMHJWHVNEFCQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.00 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|