C25H35ClO4 — CID 90383890
1-[4-[2-[4-(3-butoxypropoxy)phenyl]propan-2-yl]phenoxy]-3-chloropropan-2-ol (PubChem CID 90383890) has the molecular formula C25H35ClO4 and a molecular weight of 435.00 g/mol. Its IUPAC name is 1-[4-[2-[4-(3-butoxypropoxy)phenyl]propan-2-yl]phenoxy]-3-chloropropan-2-ol.
| Compound Name | 1-[4-[2-[4-(3-butoxypropoxy)phenyl]propan-2-yl]phenoxy]-3-chloropropan-2-ol |
|---|---|
| PubChem CID | 90383890 |
| Molecular Formula | C25H35ClO4 |
| Molecular Weight | 435.00 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 1-[4-[2-[4-(3-butoxypropoxy)phenyl]propan-2-yl]phenoxy]-3-chloropropan-2-ol |
| SMILES | CCCCOCCCOc1ccc(C(C)(C)c2ccc(OCC(O)CCl)cc2)cc1 |
| InChI | InChI=1S/C25H35ClO4/c1-4-5-15-28-16-6-17-29-23-11-7-20(8-12-23)25(2,3)21-9-13-24(14-10-21)30-19-22(27)18-26/h7-14,22,27H,4-6,15-19H2,1-3H3 |
| InChIKey | SUHPYZNMMBNXJG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.00 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|