C25H34ClIO6 — CID 144539245
4-[(2R)-3-[4-[2-[4-[(2R)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropoxy]butyl hypoiodite (PubChem CID 144539245) has the molecular formula C25H34ClIO6 and a molecular weight of 592.90 g/mol. Its IUPAC name is 4-[(2R)-3-[4-[2-[4-[(2R)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropoxy]butyl hypoiodite.
| Compound Name | 4-[(2R)-3-[4-[2-[4-[(2R)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropoxy]butyl hypoiodite |
|---|---|
| PubChem CID | 144539245 |
| Molecular Formula | C25H34ClIO6 |
| Molecular Weight | 592.90 g/mol |
| Exact Mass | 592.11 |
| IUPAC Name | 4-[(2R)-3-[4-[2-[4-[(2R)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropoxy]butyl hypoiodite |
| SMILES | CC(C)(c1ccc(OC[C@H](O)COCCCCOI)cc1)c1ccc(OC[C@@H](O)CCl)cc1 |
| InChI | InChI=1S/C25H34ClIO6/c1-25(2,19-5-9-23(10-6-19)31-17-21(28)15-26)20-7-11-24(12-8-20)32-18-22(29)16-30-13-3-4-14-33-27/h5-12,21-22,28-29H,3-4,13-18H2,1-2H3/t21-,22+/m0/s1 |
| InChIKey | SHCVAFGSWYHRIP-FCHUYYIVSA-N |
| XLogP | 4.89 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.90 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|