C23H30ClIO5 — CID 145063173
2-[3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropoxy]ethyl hypoiodite (PubChem CID 145063173) has the molecular formula C23H30ClIO5 and a molecular weight of 548.85 g/mol. Its IUPAC name is 2-[3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropoxy]ethyl hypoiodite.
| Compound Name | 2-[3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropoxy]ethyl hypoiodite |
|---|---|
| PubChem CID | 145063173 |
| Molecular Formula | C23H30ClIO5 |
| Molecular Weight | 548.85 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | 2-[3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropoxy]ethyl hypoiodite |
| SMILES | CC(C)(c1ccc(OCCCCl)cc1)c1ccc(OCC(O)COCCOI)cc1 |
| InChI | InChI=1S/C23H30ClIO5/c1-23(2,18-4-8-21(9-5-18)28-13-3-12-24)19-6-10-22(11-7-19)29-17-20(26)16-27-14-15-30-25/h4-11,20,26H,3,12-17H2,1-2H3 |
| InChIKey | RZODGQVTYCYXJS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.85 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|