C25H34ClIO6S — CID 145063140
4-[3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]sulfonylbutyl hypoiodite (PubChem CID 145063140) has the molecular formula C25H34ClIO6S and a molecular weight of 624.97 g/mol. Its IUPAC name is 4-[3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]sulfonylbutyl hypoiodite.
| Compound Name | 4-[3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]sulfonylbutyl hypoiodite |
|---|---|
| PubChem CID | 145063140 |
| Molecular Formula | C25H34ClIO6S |
| Molecular Weight | 624.97 g/mol |
| Exact Mass | 624.08 |
| IUPAC Name | 4-[3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]sulfonylbutyl hypoiodite |
| SMILES | CC(C)(c1ccc(OCCCCl)cc1)c1ccc(OCC(O)CS(=O)(=O)CCCCOI)cc1 |
| InChI | InChI=1S/C25H34ClIO6S/c1-25(2,20-6-10-23(11-7-20)31-15-5-14-26)21-8-12-24(13-9-21)32-18-22(28)19-34(29,30)17-4-3-16-33-27/h6-13,22,28H,3-5,14-19H2,1-2H3 |
| InChIKey | UPOVAXQQTZAMJF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.97 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|