C26H37ClO7S — CID 123434424
1-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-3-(4-methoxybutylsulfonyl)propan-2-ol (PubChem CID 123434424) has the molecular formula C26H37ClO7S and a molecular weight of 529.10 g/mol. Its IUPAC name is 1-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-3-(4-methoxybutylsulfonyl)propan-2-ol.
| Compound Name | 1-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-3-(4-methoxybutylsulfonyl)propan-2-ol |
|---|---|
| PubChem CID | 123434424 |
| Molecular Formula | C26H37ClO7S |
| Molecular Weight | 529.10 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 1-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-3-(4-methoxybutylsulfonyl)propan-2-ol |
| SMILES | COCCCCS(=O)(=O)CC(O)COc1ccc(C(C)(C)c2ccc(OCC(O)CCl)cc2)cc1 |
| InChI | InChI=1S/C26H37ClO7S/c1-26(2,20-6-10-24(11-7-20)33-17-22(28)16-27)21-8-12-25(13-9-21)34-18-23(29)19-35(30,31)15-5-4-14-32-3/h6-13,22-23,28-29H,4-5,14-19H2,1-3H3 |
| InChIKey | SNTVYMBTRNFYFS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.10 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|