C22H29Cl3O5 — CID 145382547
3-[2,6-dichloro-4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]propane-1,2-diol;methanol (PubChem CID 145382547) has the molecular formula C22H29Cl3O5 and a molecular weight of 479.83 g/mol. Its IUPAC name is 3-[2,6-dichloro-4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]propane-1,2-diol;methanol.
| Compound Name | 3-[2,6-dichloro-4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]propane-1,2-diol;methanol |
|---|---|
| PubChem CID | 145382547 |
| Molecular Formula | C22H29Cl3O5 |
| Molecular Weight | 479.83 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 3-[2,6-dichloro-4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]propane-1,2-diol;methanol |
| SMILES | CC(C)(c1ccc(OCCCCl)cc1)c1cc(Cl)c(OCC(O)CO)c(Cl)c1.CO |
| InChI | InChI=1S/C21H25Cl3O4.CH4O/c1-21(2,14-4-6-17(7-5-14)27-9-3-8-22)15-10-18(23)20(19(24)11-15)28-13-16(26)12-25;1-2/h4-7,10-11,16,25-26H,3,8-9,12-13H2,1-2H3;2H,1H3 |
| InChIKey | JCXQPFLMIBDPDK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.83 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|