C21H24Cl3NO3 — CID 161088782
1-amino-3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]propan-2-one (PubChem CID 161088782) has the molecular formula C21H24Cl3NO3 and a molecular weight of 444.79 g/mol. Its IUPAC name is 1-amino-3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]propan-2-one.
| Compound Name | 1-amino-3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]propan-2-one |
|---|---|
| PubChem CID | 161088782 |
| Molecular Formula | C21H24Cl3NO3 |
| Molecular Weight | 444.79 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 1-amino-3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]propan-2-one |
| SMILES | CC(C)(c1ccc(OCC(=O)CN)cc1)c1cc(Cl)c(OCCCCl)c(Cl)c1 |
| InChI | InChI=1S/C21H24Cl3NO3/c1-21(2,14-4-6-17(7-5-14)28-13-16(26)12-25)15-10-18(23)20(19(24)11-15)27-9-3-8-22/h4-7,10-11H,3,8-9,12-13,25H2,1-2H3 |
| InChIKey | RPAHZTOEKBCONS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.79 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|