C23H26Cl3F2NO5S — CID 151034328
N-[4-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-4,4-difluoro-3-oxobutyl]methanesulfonamide (PubChem CID 151034328) has the molecular formula C23H26Cl3F2NO5S and a molecular weight of 572.89 g/mol. Its IUPAC name is N-[4-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-4,4-difluoro-3-oxobutyl]methanesulfonamide.
| Compound Name | N-[4-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-4,4-difluoro-3-oxobutyl]methanesulfonamide |
|---|---|
| PubChem CID | 151034328 |
| Molecular Formula | C23H26Cl3F2NO5S |
| Molecular Weight | 572.89 g/mol |
| Exact Mass | 571.06 |
| IUPAC Name | N-[4-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-4,4-difluoro-3-oxobutyl]methanesulfonamide |
| SMILES | CC(C)(c1ccc(OC(F)(F)C(=O)CCNS(C)(=O)=O)cc1)c1cc(Cl)c(OCCCCl)c(Cl)c1 |
| InChI | InChI=1S/C23H26Cl3F2NO5S/c1-22(2,16-13-18(25)21(19(26)14-16)33-12-4-10-24)15-5-7-17(8-6-15)34-23(27,28)20(30)9-11-29-35(3,31)32/h5-8,13-14,29H,4,9-12H2,1-3H3 |
| InChIKey | MATBRDODRNTWAC-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.89 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|