C24H29Cl3O3 — CID 158661519
1-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-4-methylpentan-2-one (PubChem CID 158661519) has the molecular formula C24H29Cl3O3 and a molecular weight of 471.85 g/mol. Its IUPAC name is 1-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-4-methylpentan-2-one.
| Compound Name | 1-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-4-methylpentan-2-one |
|---|---|
| PubChem CID | 158661519 |
| Molecular Formula | C24H29Cl3O3 |
| Molecular Weight | 471.85 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 1-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-4-methylpentan-2-one |
| SMILES | CC(C)CC(=O)COc1ccc(C(C)(C)c2cc(Cl)c(OCCCCl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H29Cl3O3/c1-16(2)12-19(28)15-30-20-8-6-17(7-9-20)24(3,4)18-13-21(26)23(22(27)14-18)29-11-5-10-25/h6-9,13-14,16H,5,10-12,15H2,1-4H3 |
| InChIKey | ICUWPTZAXAMKSK-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.85 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|