C19H19Cl3O3 — CID 146484396
methyl 4-[2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propan-2-yl]benzoate (PubChem CID 146484396) has the molecular formula C19H19Cl3O3 and a molecular weight of 401.72 g/mol. Its IUPAC name is methyl 4-[2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propan-2-yl]benzoate.
| Compound Name | methyl 4-[2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propan-2-yl]benzoate |
|---|---|
| PubChem CID | 146484396 |
| Molecular Formula | C19H19Cl3O3 |
| Molecular Weight | 401.72 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | methyl 4-[2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C(C)(C)c2cc(Cl)c(OCCCl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H19Cl3O3/c1-19(2,13-6-4-12(5-7-13)18(23)24-3)14-10-15(21)17(16(22)11-14)25-9-8-20/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | FZWSMMRBJJEBOD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.72 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|