C20H21Cl3O3 — CID 146520530
ethyl 4-[2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propan-2-yl]benzoate (PubChem CID 146520530) has the molecular formula C20H21Cl3O3 and a molecular weight of 415.74 g/mol. Its IUPAC name is ethyl 4-[2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propan-2-yl]benzoate.
| Compound Name | ethyl 4-[2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propan-2-yl]benzoate |
|---|---|
| PubChem CID | 146520530 |
| Molecular Formula | C20H21Cl3O3 |
| Molecular Weight | 415.74 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | ethyl 4-[2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(C(C)(C)c2cc(Cl)c(OCCCl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H21Cl3O3/c1-4-25-19(24)13-5-7-14(8-6-13)20(2,3)15-11-16(22)18(17(23)12-15)26-10-9-21/h5-8,11-12H,4,9-10H2,1-3H3 |
| InChIKey | ZWSKQJVAACRHKP-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.74 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|