C26H33ClF2O7 — CID 155154752
methyl 4-[4-[2-(4-butoxy-3-chloro-5-methylphenyl)propan-2-yl]phenoxy]-4,4-difluoro-3,3-dihydroxy-2-methoxybutanoate (PubChem CID 155154752) has the molecular formula C26H33ClF2O7 and a molecular weight of 530.99 g/mol. Its IUPAC name is methyl 4-[4-[2-(4-butoxy-3-chloro-5-methylphenyl)propan-2-yl]phenoxy]-4,4-difluoro-3,3-dihydroxy-2-methoxybutanoate.
| Compound Name | methyl 4-[4-[2-(4-butoxy-3-chloro-5-methylphenyl)propan-2-yl]phenoxy]-4,4-difluoro-3,3-dihydroxy-2-methoxybutanoate |
|---|---|
| PubChem CID | 155154752 |
| Molecular Formula | C26H33ClF2O7 |
| Molecular Weight | 530.99 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | methyl 4-[4-[2-(4-butoxy-3-chloro-5-methylphenyl)propan-2-yl]phenoxy]-4,4-difluoro-3,3-dihydroxy-2-methoxybutanoate |
| SMILES | CCCCOc1c(C)cc(C(C)(C)c2ccc(OC(F)(F)C(O)(O)C(OC)C(=O)OC)cc2)cc1Cl |
| InChI | InChI=1S/C26H33ClF2O7/c1-7-8-13-35-21-16(2)14-18(15-20(21)27)24(3,4)17-9-11-19(12-10-17)36-26(28,29)25(31,32)22(33-5)23(30)34-6/h9-12,14-15,22,31-32H,7-8,13H2,1-6H3 |
| InChIKey | IJZLWOUHENZEPN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.99 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|