C25H30Cl2F2O5S — CID 159447026
1-[4-[2-(4-butoxy-3,5-dichlorophenyl)propan-2-yl]phenoxy]-1,1-difluoro-5-methylsulfonylpentan-2-one (PubChem CID 159447026) has the molecular formula C25H30Cl2F2O5S and a molecular weight of 551.48 g/mol. Its IUPAC name is 1-[4-[2-(4-butoxy-3,5-dichlorophenyl)propan-2-yl]phenoxy]-1,1-difluoro-5-methylsulfonylpentan-2-one.
| Compound Name | 1-[4-[2-(4-butoxy-3,5-dichlorophenyl)propan-2-yl]phenoxy]-1,1-difluoro-5-methylsulfonylpentan-2-one |
|---|---|
| PubChem CID | 159447026 |
| Molecular Formula | C25H30Cl2F2O5S |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | 1-[4-[2-(4-butoxy-3,5-dichlorophenyl)propan-2-yl]phenoxy]-1,1-difluoro-5-methylsulfonylpentan-2-one |
| SMILES | CCCCOc1c(Cl)cc(C(C)(C)c2ccc(OC(F)(F)C(=O)CCCS(C)(=O)=O)cc2)cc1Cl |
| InChI | InChI=1S/C25H30Cl2F2O5S/c1-5-6-13-33-23-20(26)15-18(16-21(23)27)24(2,3)17-9-11-19(12-10-17)34-25(28,29)22(30)8-7-14-35(4,31)32/h9-12,15-16H,5-8,13-14H2,1-4H3 |
| InChIKey | BDWOYIQNIWNOSQ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|