C25H28Cl2N2O4 — CID 159732407
N-[5-[[4-[2-(4-butoxy-3,5-dichlorophenyl)propan-2-yl]phenoxy]methyl]-1,2-oxazol-3-yl]acetamide (PubChem CID 159732407) has the molecular formula C25H28Cl2N2O4 and a molecular weight of 491.42 g/mol. Its IUPAC name is N-[5-[[4-[2-(4-butoxy-3,5-dichlorophenyl)propan-2-yl]phenoxy]methyl]-1,2-oxazol-3-yl]acetamide.
| Compound Name | N-[5-[[4-[2-(4-butoxy-3,5-dichlorophenyl)propan-2-yl]phenoxy]methyl]-1,2-oxazol-3-yl]acetamide |
|---|---|
| PubChem CID | 159732407 |
| Molecular Formula | C25H28Cl2N2O4 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | N-[5-[[4-[2-(4-butoxy-3,5-dichlorophenyl)propan-2-yl]phenoxy]methyl]-1,2-oxazol-3-yl]acetamide |
| SMILES | CCCCOc1c(Cl)cc(C(C)(C)c2ccc(OCc3cc(NC(C)=O)no3)cc2)cc1Cl |
| InChI | InChI=1S/C25H28Cl2N2O4/c1-5-6-11-31-24-21(26)12-18(13-22(24)27)25(3,4)17-7-9-19(10-8-17)32-15-20-14-23(29-33-20)28-16(2)30/h7-10,12-14H,5-6,11,15H2,1-4H3,(H,28,29,30) |
| InChIKey | LZELHRLTLSQDRD-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|