C22H23Cl3N2O2 — CID 146484352
5-[[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]methyl]-1H-imidazole (PubChem CID 146484352) has the molecular formula C22H23Cl3N2O2 and a molecular weight of 453.80 g/mol. Its IUPAC name is 5-[[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]methyl]-1H-imidazole.
| Compound Name | 5-[[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]methyl]-1H-imidazole |
|---|---|
| PubChem CID | 146484352 |
| Molecular Formula | C22H23Cl3N2O2 |
| Molecular Weight | 453.80 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 5-[[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]methyl]-1H-imidazole |
| SMILES | CC(C)(c1ccc(OCc2cnc[nH]2)cc1)c1cc(Cl)c(OCCCCl)c(Cl)c1 |
| InChI | InChI=1S/C22H23Cl3N2O2/c1-22(2,16-10-19(24)21(20(25)11-16)28-9-3-8-23)15-4-6-18(7-5-15)29-13-17-12-26-14-27-17/h4-7,10-12,14H,3,8-9,13H2,1-2H3,(H,26,27) |
| InChIKey | DBJOFYLFDIXBAK-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.80 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|