C22H26Cl3FO3 — CID 145382428
1-chloro-3-[2,6-dichloro-4-[2-[4-(4-fluorobutoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol (PubChem CID 145382428) has the molecular formula C22H26Cl3FO3 and a molecular weight of 463.80 g/mol. Its IUPAC name is 1-chloro-3-[2,6-dichloro-4-[2-[4-(4-fluorobutoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol.
| Compound Name | 1-chloro-3-[2,6-dichloro-4-[2-[4-(4-fluorobutoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 145382428 |
| Molecular Formula | C22H26Cl3FO3 |
| Molecular Weight | 463.80 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 1-chloro-3-[2,6-dichloro-4-[2-[4-(4-fluorobutoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol |
| SMILES | CC(C)(c1ccc(OCCCCF)cc1)c1cc(Cl)c(OCC(O)CCl)c(Cl)c1 |
| InChI | InChI=1S/C22H26Cl3FO3/c1-22(2,15-5-7-18(8-6-15)28-10-4-3-9-26)16-11-19(24)21(20(25)12-16)29-14-17(27)13-23/h5-8,11-12,17,27H,3-4,9-10,13-14H2,1-2H3 |
| InChIKey | DJFOXGHEGRXGEC-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.80 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|