C19H20ClF3O3 — CID 71529488
1-chloro-3-[4-[difluoro-[4-(3-fluoropropoxy)phenyl]methyl]phenoxy]propan-2-ol (PubChem CID 71529488) has the molecular formula C19H20ClF3O3 and a molecular weight of 388.81 g/mol. Its IUPAC name is 1-chloro-3-[4-[difluoro-[4-(3-fluoropropoxy)phenyl]methyl]phenoxy]propan-2-ol.
| Compound Name | 1-chloro-3-[4-[difluoro-[4-(3-fluoropropoxy)phenyl]methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 71529488 |
| Molecular Formula | C19H20ClF3O3 |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 1-chloro-3-[4-[difluoro-[4-(3-fluoropropoxy)phenyl]methyl]phenoxy]propan-2-ol |
| SMILES | OC(CCl)COc1ccc(C(F)(F)c2ccc(OCCCF)cc2)cc1 |
| InChI | InChI=1S/C19H20ClF3O3/c20-12-16(24)13-26-18-8-4-15(5-9-18)19(22,23)14-2-6-17(7-3-14)25-11-1-10-21/h2-9,16,24H,1,10-13H2 |
| InChIKey | OLJPJXHJMREJJT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|