C23H28ClF3O5 — CID 71529687
1-[4-[[4-(3-chloro-2-hydroxypropoxy)phenyl]-difluoromethyl]phenoxy]-3-(4-(18F)fluorobutoxy)propan-2-ol (PubChem CID 71529687) has the molecular formula C23H28ClF3O5 and a molecular weight of 475.92 g/mol. Its IUPAC name is 1-[4-[[4-(3-chloro-2-hydroxypropoxy)phenyl]-difluoromethyl]phenoxy]-3-(4-(18F)fluorobutoxy)propan-2-ol.
| Compound Name | 1-[4-[[4-(3-chloro-2-hydroxypropoxy)phenyl]-difluoromethyl]phenoxy]-3-(4-(18F)fluorobutoxy)propan-2-ol |
|---|---|
| PubChem CID | 71529687 |
| Molecular Formula | C23H28ClF3O5 |
| Molecular Weight | 475.92 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 1-[4-[[4-(3-chloro-2-hydroxypropoxy)phenyl]-difluoromethyl]phenoxy]-3-(4-(18F)fluorobutoxy)propan-2-ol |
| SMILES | OC(CCl)COc1ccc(C(F)(F)c2ccc(OCC(O)COCCCC[18F])cc2)cc1 |
| InChI | InChI=1S/C23H28ClF3O5/c24-13-19(28)15-31-21-7-3-17(4-8-21)23(26,27)18-5-9-22(10-6-18)32-16-20(29)14-30-12-2-1-11-25/h3-10,19-20,28-29H,1-2,11-16H2/i25-1 |
| InChIKey | XBTZNVSPPXILAE-FNNGWQQSSA-N |
| XLogP | 4.31 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.92 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|