C18H29FO7 — CID 176877657
3-[[4-[3-(5-fluoropentoxy)-2-hydroxypropoxy]phenoxy]methoxy]propane-1,2-diol (PubChem CID 176877657) has the molecular formula C18H29FO7 and a molecular weight of 376.42 g/mol. Its IUPAC name is 3-[[4-[3-(5-fluoropentoxy)-2-hydroxypropoxy]phenoxy]methoxy]propane-1,2-diol.
| Compound Name | 3-[[4-[3-(5-fluoropentoxy)-2-hydroxypropoxy]phenoxy]methoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 176877657 |
| Molecular Formula | C18H29FO7 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 3-[[4-[3-(5-fluoropentoxy)-2-hydroxypropoxy]phenoxy]methoxy]propane-1,2-diol |
| SMILES | OCC(O)COCOc1ccc(OCC(O)COCCCCCF)cc1 |
| InChI | InChI=1S/C18H29FO7/c19-8-2-1-3-9-23-12-16(22)13-25-17-4-6-18(7-5-17)26-14-24-11-15(21)10-20/h4-7,15-16,20-22H,1-3,8-14H2 |
| InChIKey | DMIKDABJRBMSQC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|