C15H32O4 — CID 78063027
3-(12-hydroxydodecoxy)propane-1,2-diol (PubChem CID 78063027) has the molecular formula C15H32O4 and a molecular weight of 276.42 g/mol. Its IUPAC name is 3-(12-hydroxydodecoxy)propane-1,2-diol.
| Compound Name | 3-(12-hydroxydodecoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 78063027 |
| Molecular Formula | C15H32O4 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 3-(12-hydroxydodecoxy)propane-1,2-diol |
| SMILES | OCCCCCCCCCCCCOCC(O)CO |
| InChI | InChI=1S/C15H32O4/c16-11-9-7-5-3-1-2-4-6-8-10-12-19-14-15(18)13-17/h15-18H,1-14H2 |
| InChIKey | JJUJIWMPUQQPPZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|