C7H16O2S2 — CID 87465197
5-[2,2-bis(sulfanyl)ethoxy]pentan-1-ol (PubChem CID 87465197) has the molecular formula C7H16O2S2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 5-[2,2-bis(sulfanyl)ethoxy]pentan-1-ol.
| Compound Name | 5-[2,2-bis(sulfanyl)ethoxy]pentan-1-ol |
|---|---|
| PubChem CID | 87465197 |
| Molecular Formula | C7H16O2S2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 5-[2,2-bis(sulfanyl)ethoxy]pentan-1-ol |
| SMILES | OCCCCCOCC(S)S |
| InChI | InChI=1S/C7H16O2S2/c8-4-2-1-3-5-9-6-7(10)11/h7-8,10-11H,1-6H2 |
| InChIKey | UAAPDISEMSKUOB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|