About 5-(2,3-diiodopropoxy)pentan-1-ol
5-(2,3-diiodopropoxy)pentan-1-ol (PubChem CID 135038659) has the molecular formula C8H16I2O2
and a molecular weight of 398.02 g/mol. Its IUPAC name is 5-(2,3-diiodopropoxy)pentan-1-ol.
Molecular Properties
| Compound Name | 5-(2,3-diiodopropoxy)pentan-1-ol |
| PubChem CID | 135038659 |
| Molecular Formula | C8H16I2O2 |
| Molecular Weight | 398.02 g/mol |
| Exact Mass | 397.92 |
| IUPAC Name | 5-(2,3-diiodopropoxy)pentan-1-ol |
| SMILES | OCCCCCOCC(I)CI |
| InChI | InChI=1S/C8H16I2O2/c9-6-8(10)7-12-5-3-1-2-4-11/h8,11H,1-7H2 |
| InChIKey | CLURZGAMAQXPPM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.02 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,3-diiodopropoxy)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-diiodopropoxy)pentan-1-ol?
The IUPAC name of 5-(2,3-diiodopropoxy)pentan-1-ol (CID 135038659) is 5-(2,3-diiodopropoxy)pentan-1-ol.
What is the SMILES notation for 5-(2,3-diiodopropoxy)pentan-1-ol?
The canonical SMILES for 5-(2,3-diiodopropoxy)pentan-1-ol is OCCCCCOCC(I)CI.
What is the InChIKey of 5-(2,3-diiodopropoxy)pentan-1-ol?
The InChIKey is CLURZGAMAQXPPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16I2O2/c9-6-8(10)7-12-5-3-1-2-4-11/h8,11H,1-7H2.
What are the key properties of 5-(2,3-diiodopropoxy)pentan-1-ol?
5-(2,3-diiodopropoxy)pentan-1-ol has a molecular weight of 398.02 g/mol, XLogP of 2.40, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-diiodopropoxy)pentan-1-ol is sourced from PubChem (CID 135038659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).