C8H16I2O2 — CID 135038659
5-(2,3-diiodopropoxy)pentan-1-ol (PubChem CID 135038659) has the molecular formula C8H16I2O2 and a molecular weight of 398.02 g/mol. Its IUPAC name is 5-(2,3-diiodopropoxy)pentan-1-ol.
| Compound Name | 5-(2,3-diiodopropoxy)pentan-1-ol |
|---|---|
| PubChem CID | 135038659 |
| Molecular Formula | C8H16I2O2 |
| Molecular Weight | 398.02 g/mol |
| Exact Mass | 397.92 |
| IUPAC Name | 5-(2,3-diiodopropoxy)pentan-1-ol |
| SMILES | OCCCCCOCC(I)CI |
| InChI | InChI=1S/C8H16I2O2/c9-6-8(10)7-12-5-3-1-2-4-11/h8,11H,1-7H2 |
| InChIKey | CLURZGAMAQXPPM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.02 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|