C20H42O8 — CID 139572770
6-[3-(3-hydroxypropoxy)-2,2-bis(3-hydroxypropoxymethyl)propoxy]hexan-1-ol (PubChem CID 139572770) has the molecular formula C20H42O8 and a molecular weight of 410.55 g/mol. Its IUPAC name is 6-[3-(3-hydroxypropoxy)-2,2-bis(3-hydroxypropoxymethyl)propoxy]hexan-1-ol.
| Compound Name | 6-[3-(3-hydroxypropoxy)-2,2-bis(3-hydroxypropoxymethyl)propoxy]hexan-1-ol |
|---|---|
| PubChem CID | 139572770 |
| Molecular Formula | C20H42O8 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | 6-[3-(3-hydroxypropoxy)-2,2-bis(3-hydroxypropoxymethyl)propoxy]hexan-1-ol |
| SMILES | OCCCCCCOCC(COCCCO)(COCCCO)COCCCO |
| InChI | InChI=1S/C20H42O8/c21-8-3-1-2-4-12-25-16-20(17-26-13-5-9-22,18-27-14-6-10-23)19-28-15-7-11-24/h21-24H,1-19H2 |
| InChIKey | OKIQZRDMQBBOBB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|