C24H48O12 — CID 58807555
CID 58807555 (PubChem CID 58807555) has the molecular formula C24H48O12 and a molecular weight of 528.64 g/mol.
| Compound Name | CID 58807555 |
|---|---|
| PubChem CID | 58807555 |
| Molecular Formula | C24H48O12 |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | — |
| SMILES | [CH]COCC(COCCO)(COCCO)COCC(COCCO)(COCCO)COCCCCO |
| InChI | InChI=1S/C24H48O12/c1-2-30-15-23(17-32-11-6-26,18-33-12-7-27)21-36-22-24(19-34-13-8-28,20-35-14-9-29)16-31-10-4-3-5-25/h1,25-29H,2-22H2 |
| InChIKey | ZPRDGOBNBOBTAK-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 165.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|