C16H34O5 — CID 71375851
3-[2-hydroxy-3-(8-methylnonoxy)propoxy]propane-1,2-diol (PubChem CID 71375851) has the molecular formula C16H34O5 and a molecular weight of 306.44 g/mol. Its IUPAC name is 3-[2-hydroxy-3-(8-methylnonoxy)propoxy]propane-1,2-diol.
| Compound Name | 3-[2-hydroxy-3-(8-methylnonoxy)propoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 71375851 |
| Molecular Formula | C16H34O5 |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | 3-[2-hydroxy-3-(8-methylnonoxy)propoxy]propane-1,2-diol |
| SMILES | CC(C)CCCCCCCOCC(O)COCC(O)CO |
| InChI | InChI=1S/C16H34O5/c1-14(2)8-6-4-3-5-7-9-20-12-16(19)13-21-11-15(18)10-17/h14-19H,3-13H2,1-2H3 |
| InChIKey | QVBVVQCUPAGFCO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|