C13H28O5 — CID 87342423
10-(2,3-dihydroxypropoxy)decane-1,1-diol (PubChem CID 87342423) has the molecular formula C13H28O5 and a molecular weight of 264.36 g/mol. Its IUPAC name is 10-(2,3-dihydroxypropoxy)decane-1,1-diol.
| Compound Name | 10-(2,3-dihydroxypropoxy)decane-1,1-diol |
|---|---|
| PubChem CID | 87342423 |
| Molecular Formula | C13H28O5 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 10-(2,3-dihydroxypropoxy)decane-1,1-diol |
| SMILES | OCC(O)COCCCCCCCCCC(O)O |
| InChI | InChI=1S/C13H28O5/c14-10-12(15)11-18-9-7-5-3-1-2-4-6-8-13(16)17/h12-17H,1-11H2 |
| InChIKey | UGPMHXXPASPEQU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|