C19H20ClF3O4 — CID 89407084
(2R)-1-[4-[[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]-difluoromethyl]phenoxy]-3-fluoropropan-2-ol (PubChem CID 89407084) has the molecular formula C19H20ClF3O4 and a molecular weight of 404.81 g/mol. Its IUPAC name is (2R)-1-[4-[[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]-difluoromethyl]phenoxy]-3-fluoropropan-2-ol.
| Compound Name | (2R)-1-[4-[[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]-difluoromethyl]phenoxy]-3-fluoropropan-2-ol |
|---|---|
| PubChem CID | 89407084 |
| Molecular Formula | C19H20ClF3O4 |
| Molecular Weight | 404.81 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (2R)-1-[4-[[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]-difluoromethyl]phenoxy]-3-fluoropropan-2-ol |
| SMILES | O[C@H](CCl)COc1ccc(C(F)(F)c2ccc(OC[C@@H](O)CF)cc2)cc1 |
| InChI | InChI=1S/C19H20ClF3O4/c20-9-15(24)11-26-17-5-1-13(2-6-17)19(22,23)14-3-7-18(8-4-14)27-12-16(25)10-21/h1-8,15-16,24-25H,9-12H2/t15-,16+/m1/s1 |
| InChIKey | ITPYCFAFLVORIF-CVEARBPZSA-N |
| XLogP | 3.51 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.81 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|