C21H25ClF2O4 — CID 89406986
3-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2,2-difluoropropan-1-ol (PubChem CID 89406986) has the molecular formula C21H25ClF2O4 and a molecular weight of 414.88 g/mol. Its IUPAC name is 3-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 89406986 |
| Molecular Formula | C21H25ClF2O4 |
| Molecular Weight | 414.88 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 3-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2,2-difluoropropan-1-ol |
| SMILES | CC(C)(c1ccc(OC[C@H](O)CCl)cc1)c1ccc(OCC(F)(F)CO)cc1 |
| InChI | InChI=1S/C21H25ClF2O4/c1-20(2,15-3-7-18(8-4-15)27-12-17(26)11-22)16-5-9-19(10-6-16)28-14-21(23,24)13-25/h3-10,17,25-26H,11-14H2,1-2H3/t17-/m1/s1 |
| InChIKey | CEPBLCBVSAEHLA-QGZVFWFLSA-N |
| XLogP | 4.00 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.88 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|