C24H27Cl3N2O3 — CID 145382414
1-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-3-imidazol-1-ylpropan-2-ol (PubChem CID 145382414) has the molecular formula C24H27Cl3N2O3 and a molecular weight of 497.85 g/mol. Its IUPAC name is 1-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-3-imidazol-1-ylpropan-2-ol.
| Compound Name | 1-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-3-imidazol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 145382414 |
| Molecular Formula | C24H27Cl3N2O3 |
| Molecular Weight | 497.85 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 1-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-3-imidazol-1-ylpropan-2-ol |
| SMILES | CC(C)(c1ccc(OCC(O)Cn2ccnc2)cc1)c1cc(Cl)c(OCCCCl)c(Cl)c1 |
| InChI | InChI=1S/C24H27Cl3N2O3/c1-24(2,18-12-21(26)23(22(27)13-18)31-11-3-8-25)17-4-6-20(7-5-17)32-15-19(30)14-29-10-9-28-16-29/h4-7,9-10,12-13,16,19,30H,3,8,11,14-15H2,1-2H3 |
| InChIKey | LNFSFQJBRSCTLD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.85 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|