C24H28Cl2N2O3 — CID 145119823
1-[4-[2-[3-chloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-3-imidazol-1-ylpropan-2-ol (PubChem CID 145119823) has the molecular formula C24H28Cl2N2O3 and a molecular weight of 463.41 g/mol. Its IUPAC name is 1-[4-[2-[3-chloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-3-imidazol-1-ylpropan-2-ol.
| Compound Name | 1-[4-[2-[3-chloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-3-imidazol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 145119823 |
| Molecular Formula | C24H28Cl2N2O3 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 1-[4-[2-[3-chloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-3-imidazol-1-ylpropan-2-ol |
| SMILES | CC(C)(c1ccc(OCC(O)Cn2ccnc2)cc1)c1ccc(OCCCCl)c(Cl)c1 |
| InChI | InChI=1S/C24H28Cl2N2O3/c1-24(2,19-6-9-23(22(26)14-19)30-13-3-10-25)18-4-7-21(8-5-18)31-16-20(29)15-28-12-11-27-17-28/h4-9,11-12,14,17,20,29H,3,10,13,15-16H2,1-2H3 |
| InChIKey | ZMDPRNJKCLJKRC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|