C18H20Cl2O2 — CID 145119525
4-[2-[3-chloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenol (PubChem CID 145119525) has the molecular formula C18H20Cl2O2 and a molecular weight of 339.26 g/mol. Its IUPAC name is 4-[2-[3-chloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenol.
| Compound Name | 4-[2-[3-chloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenol |
|---|---|
| PubChem CID | 145119525 |
| Molecular Formula | C18H20Cl2O2 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 4-[2-[3-chloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenol |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(OCCCCl)c(Cl)c1 |
| InChI | InChI=1S/C18H20Cl2O2/c1-18(2,13-4-7-15(21)8-5-13)14-6-9-17(16(20)12-14)22-11-3-10-19/h4-9,12,21H,3,10-11H2,1-2H3 |
| InChIKey | JGOUDMHCFFQWDS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|