C24H29Cl3O5 — CID 145382435
[1-chloro-3-[2-chloro-4-[2-[3-chloro-4-(3-methoxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-yl] acetate (PubChem CID 145382435) has the molecular formula C24H29Cl3O5 and a molecular weight of 503.85 g/mol. Its IUPAC name is [1-chloro-3-[2-chloro-4-[2-[3-chloro-4-(3-methoxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-yl] acetate.
| Compound Name | [1-chloro-3-[2-chloro-4-[2-[3-chloro-4-(3-methoxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-yl] acetate |
|---|---|
| PubChem CID | 145382435 |
| Molecular Formula | C24H29Cl3O5 |
| Molecular Weight | 503.85 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | [1-chloro-3-[2-chloro-4-[2-[3-chloro-4-(3-methoxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-yl] acetate |
| SMILES | COCCCOc1ccc(C(C)(C)c2ccc(OCC(CCl)OC(C)=O)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C24H29Cl3O5/c1-16(28)32-19(14-25)15-31-23-9-7-18(13-21(23)27)24(2,3)17-6-8-22(20(26)12-17)30-11-5-10-29-4/h6-9,12-13,19H,5,10-11,14-15H2,1-4H3 |
| InChIKey | BHCDWFDNBVLHDA-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.85 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|