C27H38Cl3NO3 — CID 170377920
(2R)-1-chloro-3-[2,6-dichloro-4-[2-[4-[3-(dipropylamino)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-ol (PubChem CID 170377920) has the molecular formula C27H38Cl3NO3 and a molecular weight of 530.96 g/mol. Its IUPAC name is (2R)-1-chloro-3-[2,6-dichloro-4-[2-[4-[3-(dipropylamino)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-ol.
| Compound Name | (2R)-1-chloro-3-[2,6-dichloro-4-[2-[4-[3-(dipropylamino)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 170377920 |
| Molecular Formula | C27H38Cl3NO3 |
| Molecular Weight | 530.96 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | (2R)-1-chloro-3-[2,6-dichloro-4-[2-[4-[3-(dipropylamino)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-ol |
| SMILES | CCCN(CCC)CCCOc1ccc(C(C)(C)c2cc(Cl)c(OC[C@@H](O)CCl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C27H38Cl3NO3/c1-5-12-31(13-6-2)14-7-15-33-23-10-8-20(9-11-23)27(3,4)21-16-24(29)26(25(30)17-21)34-19-22(32)18-28/h8-11,16-17,22,32H,5-7,12-15,18-19H2,1-4H3/t22-/m0/s1 |
| InChIKey | ULHIQDQGMGDYGH-QFIPXVFZSA-N |
| XLogP | 7.19 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.96 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|