C22H27Cl3N2O4S — CID 151308740
N-[3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]anilino]-2-oxopropyl]methanesulfonamide (PubChem CID 151308740) has the molecular formula C22H27Cl3N2O4S and a molecular weight of 521.89 g/mol. Its IUPAC name is N-[3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]anilino]-2-oxopropyl]methanesulfonamide.
| Compound Name | N-[3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]anilino]-2-oxopropyl]methanesulfonamide |
|---|---|
| PubChem CID | 151308740 |
| Molecular Formula | C22H27Cl3N2O4S |
| Molecular Weight | 521.89 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | N-[3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]anilino]-2-oxopropyl]methanesulfonamide |
| SMILES | CC(C)(c1ccc(NCC(=O)CNS(C)(=O)=O)cc1)c1cc(Cl)c(OCCCCl)c(Cl)c1 |
| InChI | InChI=1S/C22H27Cl3N2O4S/c1-22(2,16-11-19(24)21(20(25)12-16)31-10-4-9-23)15-5-7-17(8-6-15)26-13-18(28)14-27-32(3,29)30/h5-8,11-12,26-27H,4,9-10,13-14H2,1-3H3 |
| InChIKey | ODZCIZFMXMWYET-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.89 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|