C22H24Cl3N3O3S — CID 146535996
N-[[1-[4-[2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propan-2-yl]phenyl]imidazol-4-yl]methyl]methanesulfonamide (PubChem CID 146535996) has the molecular formula C22H24Cl3N3O3S and a molecular weight of 516.88 g/mol. Its IUPAC name is N-[[1-[4-[2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propan-2-yl]phenyl]imidazol-4-yl]methyl]methanesulfonamide.
| Compound Name | N-[[1-[4-[2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propan-2-yl]phenyl]imidazol-4-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 146535996 |
| Molecular Formula | C22H24Cl3N3O3S |
| Molecular Weight | 516.88 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | N-[[1-[4-[2-[3,5-dichloro-4-(2-chloroethoxy)phenyl]propan-2-yl]phenyl]imidazol-4-yl]methyl]methanesulfonamide |
| SMILES | CC(C)(c1ccc(-n2cnc(CNS(C)(=O)=O)c2)cc1)c1cc(Cl)c(OCCCl)c(Cl)c1 |
| InChI | InChI=1S/C22H24Cl3N3O3S/c1-22(2,16-10-19(24)21(20(25)11-16)31-9-8-23)15-4-6-18(7-5-15)28-13-17(26-14-28)12-27-32(3,29)30/h4-7,10-11,13-14,27H,8-9,12H2,1-3H3 |
| InChIKey | LZIJKBVGVUWLCQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.88 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|