C12H16O4 — CID 23448643
ethyl 4-(1,1-dihydroxypropyl)benzoate (PubChem CID 23448643) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is ethyl 4-(1,1-dihydroxypropyl)benzoate.
| Compound Name | ethyl 4-(1,1-dihydroxypropyl)benzoate |
|---|---|
| PubChem CID | 23448643 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | ethyl 4-(1,1-dihydroxypropyl)benzoate |
| SMILES | CCOC(=O)c1ccc(C(O)(O)CC)cc1 |
| InChI | InChI=1S/C12H16O4/c1-3-12(14,15)10-7-5-9(6-8-10)11(13)16-4-2/h5-8,14-15H,3-4H2,1-2H3 |
| InChIKey | SIQQENBMEQLRQT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|