C18H21O5P — CID 66841765
[4-[2-(4-methoxycarbonylphenyl)propan-2-yl]phenyl]methylphosphonic acid (PubChem CID 66841765) has the molecular formula C18H21O5P and a molecular weight of 348.34 g/mol. Its IUPAC name is [4-[2-(4-methoxycarbonylphenyl)propan-2-yl]phenyl]methylphosphonic acid.
| Compound Name | [4-[2-(4-methoxycarbonylphenyl)propan-2-yl]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 66841765 |
| Molecular Formula | C18H21O5P |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | [4-[2-(4-methoxycarbonylphenyl)propan-2-yl]phenyl]methylphosphonic acid |
| SMILES | COC(=O)c1ccc(C(C)(C)c2ccc(CP(=O)(O)O)cc2)cc1 |
| InChI | InChI=1S/C18H21O5P/c1-18(2,16-10-6-14(7-11-16)17(19)23-3)15-8-4-13(5-9-15)12-24(20,21)22/h4-11H,12H2,1-3H3,(H2,20,21,22) |
| InChIKey | LYOLKJSWQQCUPR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|