C10H15O8P2+ — CID 87815910
dihydroxy(oxo)phosphanium;2-(4-methoxycarbonylphenyl)ethylphosphonic acid (PubChem CID 87815910) has the molecular formula C10H15O8P2+ and a molecular weight of 325.17 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;2-(4-methoxycarbonylphenyl)ethylphosphonic acid.
| Compound Name | dihydroxy(oxo)phosphanium;2-(4-methoxycarbonylphenyl)ethylphosphonic acid |
|---|---|
| PubChem CID | 87815910 |
| Molecular Formula | C10H15O8P2+ |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | dihydroxy(oxo)phosphanium;2-(4-methoxycarbonylphenyl)ethylphosphonic acid |
| SMILES | COC(=O)c1ccc(CCP(=O)(O)O)cc1.O=[P+](O)O |
| InChI | InChI=1S/C10H13O5P.HO3P/c1-15-10(11)9-4-2-8(3-5-9)6-7-16(12,13)14;1-4(2)3/h2-5H,6-7H2,1H3,(H2,12,13,14);(H-,1,2,3)/p+1 |
| InChIKey | HSUDMUOXBHLABL-UHFFFAOYSA-O |
| XLogP | 0.82 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|